C28H36N4OS — CID 3192122
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethylphenyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]thiourea (PubChem CID 3192122) has the molecular formula C28H36N4OS and a molecular weight of 476.69 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethylphenyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethylphenyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3192122 |
| Molecular Formula | C28H36N4OS |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethylphenyl)-1-[(1-ethylpyrrolidin-2-yl)methyl]thiourea |
| SMILES | CCc1ccc(NC(=S)N(Cc2cc3ccc(C)c(C)c3[nH]c2=O)CC2CCCN2CC)cc1 |
| InChI | InChI=1S/C28H36N4OS/c1-5-21-10-13-24(14-11-21)29-28(34)32(18-25-8-7-15-31(25)6-2)17-23-16-22-12-9-19(3)20(4)26(22)30-27(23)33/h9-14,16,25H,5-8,15,17-18H2,1-4H3,(H,29,34)(H,30,33) |
| InChIKey | CCCVGCQWKWBAMQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|