C28H36N4O2S — CID 25409633
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethoxyphenyl)-1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]thiourea (PubChem CID 25409633) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethoxyphenyl)-1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethoxyphenyl)-1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 25409633 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-ethoxyphenyl)-1-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)N(Cc1cc2ccc(C)c(C)c2[nH]c1=O)C[C@@H]1CCCN1CC |
| InChI | InChI=1S/C28H36N4O2S/c1-5-31-15-9-10-23(31)18-32(28(35)29-24-11-7-8-12-25(24)34-6-2)17-22-16-21-14-13-19(3)20(4)26(21)30-27(22)33/h7-8,11-14,16,23H,5-6,9-10,15,17-18H2,1-4H3,(H,29,35)(H,30,33)/t23-/m0/s1 |
| InChIKey | BHNGUYDXUPDCOT-QHCPKHFHSA-N |
| XLogP | 5.23 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|