C26H26N2O5 — CID 31929210
N-[4-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 31929210) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[4-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31929210 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[4-[2,3-dihydro-1,4-benzodioxin-6-yl-[(E)-3-phenylprop-2-enyl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(NCCCC(=O)N(C/C=C/c1ccccc1)c1ccc2c(c1)OCCO2)c1ccco1 |
| InChI | InChI=1S/C26H26N2O5/c29-25(11-4-14-27-26(30)23-10-6-16-31-23)28(15-5-9-20-7-2-1-3-8-20)21-12-13-22-24(19-21)33-18-17-32-22/h1-3,5-10,12-13,16,19H,4,11,14-15,17-18H2,(H,27,30)/b9-5+ |
| InChIKey | FFZHEAIXMTZENY-WEVVVXLNSA-N |
| XLogP | 4.31 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|