C23H30FN5 — CID 3193721
N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-[(4-fluorophenyl)methyl]-2-methylpropan-1-amine (PubChem CID 3193721) has the molecular formula C23H30FN5 and a molecular weight of 395.53 g/mol. Its IUPAC name is N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-[(4-fluorophenyl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-[(4-fluorophenyl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 3193721 |
| Molecular Formula | C23H30FN5 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | N-benzyl-1-(1-tert-butyltetrazol-5-yl)-N-[(4-fluorophenyl)methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)C(c1nnnn1C(C)(C)C)N(Cc1ccccc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FN5/c1-17(2)21(22-25-26-27-29(22)23(3,4)5)28(15-18-9-7-6-8-10-18)16-19-11-13-20(24)14-12-19/h6-14,17,21H,15-16H2,1-5H3 |
| InChIKey | UVOAHZDSQFHIHG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |