C14H16F3N3O3 — CID 31937890
1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-4-carboxamide (PubChem CID 31937890) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31937890 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Cn2cccc(C(F)(F)F)c2=O)CC1 |
| InChI | InChI=1S/C14H16F3N3O3/c15-14(16,17)10-2-1-5-20(13(10)23)8-11(21)19-6-3-9(4-7-19)12(18)22/h1-2,5,9H,3-4,6-8H2,(H2,18,22) |
| InChIKey | PXRJBTFYKMYTJS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |