C24H26ClN3O4 — CID 3194807
3-(3-chlorophenyl)-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea (PubChem CID 3194807) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3194807 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CC3CCCO3)C(=O)Nc3cccc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C24H26ClN3O4/c1-2-31-20-8-9-22-16(12-20)11-17(23(29)27-22)14-28(15-21-7-4-10-32-21)24(30)26-19-6-3-5-18(25)13-19/h3,5-6,8-9,11-13,21H,2,4,7,10,14-15H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | BGOCRLFNVHHJLT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |