C15H17N9O2 — CID 3195221
N-(oxolan-2-ylmethyl)-2-[5-[2-(tetrazol-1-yl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 3195221) has the molecular formula C15H17N9O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[5-[2-(tetrazol-1-yl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[5-[2-(tetrazol-1-yl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3195221 |
| Molecular Formula | C15H17N9O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[5-[2-(tetrazol-1-yl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2-n2cnnn2)n1)NCC1CCCO1 |
| InChI | InChI=1S/C15H17N9O2/c25-14(16-8-11-4-3-7-26-11)9-24-19-15(18-21-24)12-5-1-2-6-13(12)23-10-17-20-22-23/h1-2,5-6,10-11H,3-4,7-9H2,(H,16,25) |
| InChIKey | CMZSUHYZRDLNCP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |