C24H18FN3O3 — CID 31966495
N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 31966495) has the molecular formula C24H18FN3O3 and a molecular weight of 415.42 g/mol. Its IUPAC name is N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 31966495 |
| Molecular Formula | C24H18FN3O3 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[[4-(4-fluorophenoxy)phenyl]methyl]-6-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)cc1)c1ccc(=O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H18FN3O3/c25-18-8-12-21(13-9-18)31-20-10-6-17(7-11-20)16-26-24(30)22-14-15-23(29)28(27-22)19-4-2-1-3-5-19/h1-15H,16H2,(H,26,30) |
| InChIKey | AXJGXCZVWROEJS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |