C26H30FN5O2S2 — CID 3197466
2-[2-[4-(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide (PubChem CID 3197466) has the molecular formula C26H30FN5O2S2 and a molecular weight of 527.69 g/mol. Its IUPAC name is 2-[2-[4-(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[4-(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3197466 |
| Molecular Formula | C26H30FN5O2S2 |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-[2-[4-(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide |
| SMILES | Cc1nc(N2CCN(C(=O)CSCC(=O)Nc3ccc(F)cc3)CC2)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C26H30FN5O2S2/c1-16-3-8-20-21(13-16)36-26-24(20)25(28-17(2)29-26)32-11-9-31(10-12-32)23(34)15-35-14-22(33)30-19-6-4-18(27)5-7-19/h4-7,16H,3,8-15H2,1-2H3,(H,30,33) |
| InChIKey | RHIAGNXIKUPUOF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |