C23H26FN5OS — CID 1452133
4-[(7S)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 1452133) has the molecular formula C23H26FN5OS and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[(7S)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(7S)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 1452133 |
| Molecular Formula | C23H26FN5OS |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-[(7S)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]-N-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | Cc1nc(N2CCN(C(=O)Nc3ccc(F)cc3)CC2)c2c3c(sc2n1)C[C@@H](C)CC3 |
| InChI | InChI=1S/C23H26FN5OS/c1-14-3-8-18-19(13-14)31-22-20(18)21(25-15(2)26-22)28-9-11-29(12-10-28)23(30)27-17-6-4-16(24)5-7-17/h4-7,14H,3,8-13H2,1-2H3,(H,27,30)/t14-/m0/s1 |
| InChIKey | YZIYLZVNQHGIOY-AWEZNQCLSA-N |
| XLogP | 4.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |