C31H35N5OS — CID 42799916
4-(2-benzyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-N-(3,4-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 42799916) has the molecular formula C31H35N5OS and a molecular weight of 525.72 g/mol. Its IUPAC name is 4-(2-benzyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-N-(3,4-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-benzyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-N-(3,4-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42799916 |
| Molecular Formula | C31H35N5OS |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 4-(2-benzyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)-N-(3,4-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(c3nc(Cc4ccccc4)nc4sc5c(c34)CCC(C)C5)CC2)cc1C |
| InChI | InChI=1S/C31H35N5OS/c1-20-9-12-25-26(17-20)38-30-28(25)29(33-27(34-30)19-23-7-5-4-6-8-23)35-13-15-36(16-14-35)31(37)32-24-11-10-21(2)22(3)18-24/h4-8,10-11,18,20H,9,12-17,19H2,1-3H3,(H,32,37) |
| InChIKey | FIIXFLCXHGKRHK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |