About Dhac
Dhac (PubChem CID 319859) has the molecular formula C8H14N4O5
and a molecular weight of 246.22 g/mol. Its IUPAC name is 6-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | Dhac |
| PubChem CID | 319859 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one |
| SMILES | C1N=C(NC(=O)N1C2C(C(C(O2)CO)O)O)N |
| InChI | InChI=1S/C8H14N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h3-6,13-15H,1-2H2,(H3,9,10,11,16) |
| InChIKey | LJIRBXZDQGQUOO-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 349 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Dhac with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dhac?
The IUPAC name of Dhac (CID 319859) is 6-amino-3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one.
What is the SMILES notation for Dhac?
The canonical SMILES for Dhac is C1N=C(NC(=O)N1C2C(C(C(O2)CO)O)O)N.
What is the InChIKey of Dhac?
The InChIKey is LJIRBXZDQGQUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h3-6,13-15H,1-2H2,(H3,9,10,11,16).
What are the key properties of Dhac?
Dhac has a molecular weight of 246.22 g/mol, XLogP of -3.00, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Dhac is sourced from PubChem (CID 319859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).