C8H12N4O5 — CID 460485
4-amino-1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,3,5-triazin-2-one (PubChem CID 460485) has the molecular formula C8H12N4O5 and a molecular weight of 244.20 g/mol. Its IUPAC name is 4-amino-1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 460485 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-amino-1-[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | C1=NC(=NC(=O)N1[C@@H]2[C@H]([C@@H]([C@@H](O2)CO)O)O)N |
| InChI | InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4+,5-,6-/m0/s1 |
| InChIKey | NMUSYJAQQFHJEW-FSIIMWSLSA-N |
| XLogP | -2.20 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 384 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |