C17H21F3N2O3S — CID 31999391
N-[[(2R)-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 31999391) has the molecular formula C17H21F3N2O3S and a molecular weight of 390.43 g/mol. Its IUPAC name is N-[[(2R)-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(2R)-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 31999391 |
| Molecular Formula | C17H21F3N2O3S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[[(2R)-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1CCCCN1C(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O3S/c1-26(24,25)21-12-15-4-2-3-11-22(15)16(23)10-7-13-5-8-14(9-6-13)17(18,19)20/h5-10,15,21H,2-4,11-12H2,1H3/b10-7+/t15-/m1/s1 |
| InChIKey | HFYYJLZUPRTFTB-JOZWUWCOSA-N |
| XLogP | 2.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|