C18H26N2O4S — CID 43062849
N-[[1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 43062849) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-[[1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 43062849 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[[1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCCCC2CNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-3-24-17-10-7-15(8-11-17)9-12-18(21)20-13-5-4-6-16(20)14-19-25(2,22)23/h7-12,16,19H,3-6,13-14H2,1-2H3/b12-9+ |
| InChIKey | ABPJVWNFGRCZMI-FMIVXFBMSA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|