C16H24N2O4S — CID 31998085
N-[[(2R)-1-[2-(4-methylphenoxy)acetyl]piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 31998085) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is N-[[(2R)-1-[2-(4-methylphenoxy)acetyl]piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(2R)-1-[2-(4-methylphenoxy)acetyl]piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 31998085 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[[(2R)-1-[2-(4-methylphenoxy)acetyl]piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | Cc1ccc(OCC(=O)N2CCCC[C@@H]2CNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H24N2O4S/c1-13-6-8-15(9-7-13)22-12-16(19)18-10-4-3-5-14(18)11-17-23(2,20)21/h6-9,14,17H,3-5,10-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | MEFUSHWUPDTWJG-CQSZACIVSA-N |
| XLogP | 1.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |