C11H20N2O6S — CID 61329043
2-[2-[2-(methanesulfonamidomethyl)piperidin-1-yl]-2-oxoethoxy]acetic acid (PubChem CID 61329043) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[2-[2-(methanesulfonamidomethyl)piperidin-1-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[2-(methanesulfonamidomethyl)piperidin-1-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329043 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[2-[2-(methanesulfonamidomethyl)piperidin-1-yl]-2-oxoethoxy]acetic acid |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)COCC(=O)O |
| InChI | InChI=1S/C11H20N2O6S/c1-20(17,18)12-6-9-4-2-3-5-13(9)10(14)7-19-8-11(15)16/h9,12H,2-8H2,1H3,(H,15,16) |
| InChIKey | BZJOTUYAUVQILI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |