C12H24N2O5S2 — CID 132968697
N-[[1-(2-propylsulfonylacetyl)piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 132968697) has the molecular formula C12H24N2O5S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[[1-(2-propylsulfonylacetyl)piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(2-propylsulfonylacetyl)piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 132968697 |
| Molecular Formula | C12H24N2O5S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[[1-(2-propylsulfonylacetyl)piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CCCS(=O)(=O)CC(=O)N1CCCCC1CNS(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O5S2/c1-3-8-21(18,19)10-12(15)14-7-5-4-6-11(14)9-13-20(2,16)17/h11,13H,3-10H2,1-2H3 |
| InChIKey | IWVGJKLDIOHDQO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |