C11H24ClN3O3S — CID 119722459
N-[[1-(3-aminobutanoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride (PubChem CID 119722459) has the molecular formula C11H24ClN3O3S and a molecular weight of 313.85 g/mol. Its IUPAC name is N-[[1-(3-aminobutanoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[[1-(3-aminobutanoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119722459 |
| Molecular Formula | C11H24ClN3O3S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[[1-(3-aminobutanoyl)piperidin-2-yl]methyl]methanesulfonamide;hydrochloride |
| SMILES | CC(N)CC(=O)N1CCCCC1CNS(C)(=O)=O.Cl |
| InChI | InChI=1S/C11H23N3O3S.ClH/c1-9(12)7-11(15)14-6-4-3-5-10(14)8-13-18(2,16)17;/h9-10,13H,3-8,12H2,1-2H3;1H |
| InChIKey | GDHVNLVUTOVTMN-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |