C23H25N3O5S2 — CID 3200175
2-[[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 3200175) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 3200175 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-[[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)CSc2nc(C)nc3sc4c(c23)CCC(C)C4)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C23H25N3O5S2/c1-11-5-6-13-18(7-11)33-22-20(13)21(24-12(2)25-22)32-10-19(27)26-15-9-17(31-4)16(30-3)8-14(15)23(28)29/h8-9,11H,5-7,10H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | BVEYVMOYIWOLPO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |