C24H29N3O3S2 — CID 1465316
N-(2,5-dimethoxyphenyl)-2-[[(7S)-7-methyl-2-propan-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide (PubChem CID 1465316) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[[(7S)-7-methyl-2-propan-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[[(7S)-7-methyl-2-propan-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1465316 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[[(7S)-7-methyl-2-propan-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nc(C(C)C)nc3sc4c(c23)CC[C@H](C)C4)c1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-13(2)22-26-23(21-16-8-6-14(3)10-19(16)32-24(21)27-22)31-12-20(28)25-17-11-15(29-4)7-9-18(17)30-5/h7,9,11,13-14H,6,8,10,12H2,1-5H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | KGHDGJPVKCPUCF-AWEZNQCLSA-N |
| XLogP | 5.69 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |