C18H24N6O2S2 — CID 3204029
N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]-2-methylpropanehydrazide (PubChem CID 3204029) has the molecular formula C18H24N6O2S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]-2-methylpropanehydrazide.
| Compound Name | N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 3204029 |
| Molecular Formula | C18H24N6O2S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N'-[2-[(11,12-dimethyl-7-propan-2-yl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]acetyl]-2-methylpropanehydrazide |
| SMILES | Cc1sc2nc(C(C)C)n3c(SCC(=O)NNC(=O)C(C)C)nnc3c2c1C |
| InChI | InChI=1S/C18H24N6O2S2/c1-8(2)14-19-17-13(10(5)11(6)28-17)15-21-23-18(24(14)15)27-7-12(25)20-22-16(26)9(3)4/h8-9H,7H2,1-6H3,(H,20,25)(H,22,26) |
| InChIKey | VMNLBHQYHXUAHV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|