C24H35N3O4 — CID 3207178
methyl 4-[[2-(cyclohexylamino)acetyl]-[2-(cyclohexylamino)-2-oxoethyl]amino]benzoate (PubChem CID 3207178) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl 4-[[2-(cyclohexylamino)acetyl]-[2-(cyclohexylamino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(cyclohexylamino)acetyl]-[2-(cyclohexylamino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 3207178 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | methyl 4-[[2-(cyclohexylamino)acetyl]-[2-(cyclohexylamino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)NC2CCCCC2)C(=O)CNC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H35N3O4/c1-31-24(30)18-12-14-21(15-13-18)27(17-22(28)26-20-10-6-3-7-11-20)23(29)16-25-19-8-4-2-5-9-19/h12-15,19-20,25H,2-11,16-17H2,1H3,(H,26,28) |
| InChIKey | JDXSXYOHUFGSHN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |