C21H18N2O2S — CID 3207760
benzyl 2-(3-cyano-7,8-dimethylquinolin-2-yl)sulfanylacetate (PubChem CID 3207760) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is benzyl 2-(3-cyano-7,8-dimethylquinolin-2-yl)sulfanylacetate.
| Compound Name | benzyl 2-(3-cyano-7,8-dimethylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3207760 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | benzyl 2-(3-cyano-7,8-dimethylquinolin-2-yl)sulfanylacetate |
| SMILES | Cc1ccc2cc(C#N)c(SCC(=O)OCc3ccccc3)nc2c1C |
| InChI | InChI=1S/C21H18N2O2S/c1-14-8-9-17-10-18(11-22)21(23-20(17)15(14)2)26-13-19(24)25-12-16-6-4-3-5-7-16/h3-10H,12-13H2,1-2H3 |
| InChIKey | FMAYWHWQMPNKOC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |