C25H34FN7 — CID 3210367
4-[[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline (PubChem CID 3210367) has the molecular formula C25H34FN7 and a molecular weight of 451.59 g/mol. Its IUPAC name is 4-[[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3210367 |
| Molecular Formula | C25H34FN7 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 4-[[4-(2-fluorophenyl)piperazin-1-yl]-[1-(3-methylbutyl)tetrazol-5-yl]methyl]-N,N-dimethylaniline |
| SMILES | CC(C)CCn1nnnc1C(c1ccc(N(C)C)cc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H34FN7/c1-19(2)13-14-33-25(27-28-29-33)24(20-9-11-21(12-10-20)30(3)4)32-17-15-31(16-18-32)23-8-6-5-7-22(23)26/h5-12,19,24H,13-18H2,1-4H3 |
| InChIKey | SCYQCNKNTMPDAJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|