C26H33N3O5 — CID 3211818
N-[2-[[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 3211818) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[2-[[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3211818 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[2-[[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]-prop-2-enylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | C=CCN(C(=O)CNC(=O)c1ccco1)C(C(=O)NC1CCCCC1)c1ccccc1OCC |
| InChI | InChI=1S/C26H33N3O5/c1-3-16-29(23(30)18-27-25(31)22-15-10-17-34-22)24(20-13-8-9-14-21(20)33-4-2)26(32)28-19-11-6-5-7-12-19/h3,8-10,13-15,17,19,24H,1,4-7,11-12,16,18H2,2H3,(H,27,31)(H,28,32) |
| InChIKey | DPJAAZPQEHAVMO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|