C24H31N5O3 — CID 3212031
2-[[2-(benzotriazol-1-yl)acetyl]-(3-methylbutyl)amino]-N-(2-methoxyethyl)-2-phenylacetamide (PubChem CID 3212031) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-(3-methylbutyl)amino]-N-(2-methoxyethyl)-2-phenylacetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(3-methylbutyl)amino]-N-(2-methoxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 3212031 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-(3-methylbutyl)amino]-N-(2-methoxyethyl)-2-phenylacetamide |
| SMILES | COCCNC(=O)C(c1ccccc1)N(CCC(C)C)C(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C24H31N5O3/c1-18(2)13-15-28(22(30)17-29-21-12-8-7-11-20(21)26-27-29)23(19-9-5-4-6-10-19)24(31)25-14-16-32-3/h4-12,18,23H,13-17H2,1-3H3,(H,25,31) |
| InChIKey | ZDJWPWTWUNUVMD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|