C24H29N5O3 — CID 3212135
2-[[2-(benzotriazol-1-yl)acetyl]-prop-2-enylamino]-2-(4-ethylphenyl)-N-(2-methoxyethyl)acetamide (PubChem CID 3212135) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[[2-(benzotriazol-1-yl)acetyl]-prop-2-enylamino]-2-(4-ethylphenyl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[2-(benzotriazol-1-yl)acetyl]-prop-2-enylamino]-2-(4-ethylphenyl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3212135 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[[2-(benzotriazol-1-yl)acetyl]-prop-2-enylamino]-2-(4-ethylphenyl)-N-(2-methoxyethyl)acetamide |
| SMILES | C=CCN(C(=O)Cn1nnc2ccccc21)C(C(=O)NCCOC)c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H29N5O3/c1-4-15-28(22(30)17-29-21-9-7-6-8-20(21)26-27-29)23(24(31)25-14-16-32-3)19-12-10-18(5-2)11-13-19/h4,6-13,23H,1,5,14-17H2,2-3H3,(H,25,31) |
| InChIKey | FYWAJISBFMIIII-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|