C25H24FN5O3 — CID 3212119
2-(N-[2-(benzotriazol-1-yl)acetyl]anilino)-2-(2-fluorophenyl)-N-(2-methoxyethyl)acetamide (PubChem CID 3212119) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-(N-[2-(benzotriazol-1-yl)acetyl]anilino)-2-(2-fluorophenyl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]anilino)-2-(2-fluorophenyl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3212119 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]anilino)-2-(2-fluorophenyl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C(c1ccccc1F)N(C(=O)Cn1nnc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H24FN5O3/c1-34-16-15-27-25(33)24(19-11-5-6-12-20(19)26)31(18-9-3-2-4-10-18)23(32)17-30-22-14-8-7-13-21(22)28-29-30/h2-14,24H,15-17H2,1H3,(H,27,33) |
| InChIKey | DSXLLOFGQDATCD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|