C26H29N5O5 — CID 3778212
2-(N-[2-(benzotriazol-1-yl)acetyl]-4-ethoxyanilino)-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide (PubChem CID 3778212) has the molecular formula C26H29N5O5 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-(N-[2-(benzotriazol-1-yl)acetyl]-4-ethoxyanilino)-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide.
| Compound Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-4-ethoxyanilino)-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide |
|---|---|
| PubChem CID | 3778212 |
| Molecular Formula | C26H29N5O5 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-(N-[2-(benzotriazol-1-yl)acetyl]-4-ethoxyanilino)-N-(2-methoxyethyl)-2-(5-methylfuran-2-yl)acetamide |
| SMILES | CCOc1ccc(N(C(=O)Cn2nnc3ccccc32)C(C(=O)NCCOC)c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C26H29N5O5/c1-4-35-20-12-10-19(11-13-20)31(24(32)17-30-22-8-6-5-7-21(22)28-29-30)25(23-14-9-18(2)36-23)26(33)27-15-16-34-3/h5-14,25H,4,15-17H2,1-3H3,(H,27,33) |
| InChIKey | MGQPTYIDGIELBE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|