C20H26ClN3O2S — CID 3212459
2-[5-(4-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-cyclohexylacetamide (PubChem CID 3212459) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-cyclohexylacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 3212459 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-cyclohexylacetamide |
| SMILES | COCCn1c(-c2ccc(Cl)cc2)cnc1SCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H26ClN3O2S/c1-26-12-11-24-18(15-7-9-16(21)10-8-15)13-22-20(24)27-14-19(25)23-17-5-3-2-4-6-17/h7-10,13,17H,2-6,11-12,14H2,1H3,(H,23,25) |
| InChIKey | MHAOVDSWCCCQGM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|