C25H29FN4O4S2 — CID 3212445
2-[5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 3212445) has the molecular formula C25H29FN4O4S2 and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 3212445 |
| Molecular Formula | C25H29FN4O4S2 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1-(2-methoxyethyl)imidazol-2-yl]sulfanyl-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | COCCn1c(-c2ccc(F)cc2)cnc1SCC(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H29FN4O4S2/c1-34-16-15-30-23(19-5-7-20(26)8-6-19)17-27-25(30)35-18-24(31)28-21-9-11-22(12-10-21)36(32,33)29-13-3-2-4-14-29/h5-12,17H,2-4,13-16,18H2,1H3,(H,28,31) |
| InChIKey | YALCPVJXBQVLCU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|