C26H32N4O4S2 — CID 56675316
1-[1-(2-methoxyethyl)-5-phenylimidazol-2-yl]sulfanyl-3-(4-piperidin-1-ylsulfonylanilino)propan-2-one (PubChem CID 56675316) has the molecular formula C26H32N4O4S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)-5-phenylimidazol-2-yl]sulfanyl-3-(4-piperidin-1-ylsulfonylanilino)propan-2-one.
| Compound Name | 1-[1-(2-methoxyethyl)-5-phenylimidazol-2-yl]sulfanyl-3-(4-piperidin-1-ylsulfonylanilino)propan-2-one |
|---|---|
| PubChem CID | 56675316 |
| Molecular Formula | C26H32N4O4S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-[1-(2-methoxyethyl)-5-phenylimidazol-2-yl]sulfanyl-3-(4-piperidin-1-ylsulfonylanilino)propan-2-one |
| SMILES | COCCn1c(-c2ccccc2)cnc1SCC(=O)CNc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H32N4O4S2/c1-34-17-16-30-25(21-8-4-2-5-9-21)19-28-26(30)35-20-23(31)18-27-22-10-12-24(13-11-22)36(32,33)29-14-6-3-7-15-29/h2,4-5,8-13,19,27H,3,6-7,14-18,20H2,1H3 |
| InChIKey | IFIFPOXIVQHJMU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|