C20H28N6O3S — CID 3213006
N-(2-methylcyclohexyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 3213006) has the molecular formula C20H28N6O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(2-methylcyclohexyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3213006 |
| Molecular Formula | C20H28N6O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-(2-methylcyclohexyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC1CCCCC1NC(=O)C1CCN(S(=O)(=O)c2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C20H28N6O3S/c1-15-4-2-3-5-19(15)22-20(27)16-10-12-25(13-11-16)30(28,29)18-8-6-17(7-9-18)26-14-21-23-24-26/h6-9,14-16,19H,2-5,10-13H2,1H3,(H,22,27) |
| InChIKey | JNHUDBHMUSMDDS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |