C16H20N6O3S — CID 3215997
N-prop-2-enyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 3215997) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-prop-2-enyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | N-prop-2-enyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3215997 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-prop-2-enyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1CCCN(S(=O)(=O)c2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C16H20N6O3S/c1-2-9-17-16(23)13-4-3-10-21(11-13)26(24,25)15-7-5-14(6-8-15)22-12-18-19-20-22/h2,5-8,12-13H,1,3-4,9-11H2,(H,17,23) |
| InChIKey | GSICEAGXINKKFW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|