C27H32N2O6 — CID 3216066
N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-oxobut-2-enamide (PubChem CID 3216066) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-oxobut-2-enamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 3216066 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxoethyl]-4-(2-hydroxy-4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]-4-oxobut-2-enamide |
| SMILES | COc1ccc(C(=O)C=CC(=O)N(CC(=O)NC2CCCCC2)Cc2ccccc2OC)c(O)c1 |
| InChI | InChI=1S/C27H32N2O6/c1-34-21-12-13-22(24(31)16-21)23(30)14-15-27(33)29(17-19-8-6-7-11-25(19)35-2)18-26(32)28-20-9-4-3-5-10-20/h6-8,11-16,20,31H,3-5,9-10,17-18H2,1-2H3,(H,28,32) |
| InChIKey | PDVMBRVMTLWCSP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|