C26H27N3O3 — CID 3216656
N-[2-(benzylamino)-2-oxo-1-phenylethyl]-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 3216656) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxo-1-phenylethyl]-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxo-1-phenylethyl]-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 3216656 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[2-(benzylamino)-2-oxo-1-phenylethyl]-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccccc1)N(CC1CCCO1)C(=O)c1ccccn1 |
| InChI | InChI=1S/C26H27N3O3/c30-25(28-18-20-10-3-1-4-11-20)24(21-12-5-2-6-13-21)29(19-22-14-9-17-32-22)26(31)23-15-7-8-16-27-23/h1-8,10-13,15-16,22,24H,9,14,17-19H2,(H,28,30) |
| InChIKey | IMUMFQSYOWQWGR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |