C24H26N4O2S — CID 3219206
N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-(3-methylphenyl)thiadiazole-4-carboxamide (PubChem CID 3219206) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-(3-methylphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-(3-methylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3219206 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-N-(3-methylphenyl)thiadiazole-4-carboxamide |
| SMILES | Cc1cccc(N(C(=O)c2csnn2)C(C(=O)NC2CCCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N4O2S/c1-17-9-8-14-20(15-17)28(24(30)21-16-31-27-26-21)22(18-10-4-2-5-11-18)23(29)25-19-12-6-3-7-13-19/h2,4-5,8-11,14-16,19,22H,3,6-7,12-13H2,1H3,(H,25,29) |
| InChIKey | USPRDMFVMIBBBZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |