C21H21N5O2S — CID 24792301
N-[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide (PubChem CID 24792301) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 24792301 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)C(c1cccnc1)N(C(=O)c1csnn1)c1ccccc1 |
| InChI | InChI=1S/C21H21N5O2S/c27-20(23-16-8-4-5-9-16)19(15-7-6-12-22-13-15)26(17-10-2-1-3-11-17)21(28)18-14-29-25-24-18/h1-3,6-7,10-14,16,19H,4-5,8-9H2,(H,23,27) |
| InChIKey | UAKIZNFYLYTSQN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |