C23H19N5O2S — CID 51552695
N-[(1R)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide (PubChem CID 51552695) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is N-[(1R)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide.
| Compound Name | N-[(1R)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 51552695 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[(1R)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl]-N-phenylthiadiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](c1cccnc1)N(C(=O)c1csnn1)c1ccccc1 |
| InChI | InChI=1S/C23H19N5O2S/c29-22(25-14-17-8-3-1-4-9-17)21(18-10-7-13-24-15-18)28(19-11-5-2-6-12-19)23(30)20-16-31-27-26-20/h1-13,15-16,21H,14H2,(H,25,29)/t21-/m1/s1 |
| InChIKey | SKKXQZPYRNYLTO-OAQYLSRUSA-N |
| XLogP | 3.64 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |