C23H18FN5O2S — CID 3222013
N-[2-(benzylamino)-2-oxo-1-pyridin-4-ylethyl]-N-(3-fluorophenyl)thiadiazole-4-carboxamide (PubChem CID 3222013) has the molecular formula C23H18FN5O2S and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[2-(benzylamino)-2-oxo-1-pyridin-4-ylethyl]-N-(3-fluorophenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-2-oxo-1-pyridin-4-ylethyl]-N-(3-fluorophenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3222013 |
| Molecular Formula | C23H18FN5O2S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[2-(benzylamino)-2-oxo-1-pyridin-4-ylethyl]-N-(3-fluorophenyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccncc1)N(C(=O)c1csnn1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H18FN5O2S/c24-18-7-4-8-19(13-18)29(23(31)20-15-32-28-27-20)21(17-9-11-25-12-10-17)22(30)26-14-16-5-2-1-3-6-16/h1-13,15,21H,14H2,(H,26,30) |
| InChIKey | USRWUELIMJJOIP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |