C22H17FN4O3S — CID 3221752
N-[2-(benzylamino)-1-(furan-2-yl)-2-oxoethyl]-N-(4-fluorophenyl)thiadiazole-4-carboxamide (PubChem CID 3221752) has the molecular formula C22H17FN4O3S and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[2-(benzylamino)-1-(furan-2-yl)-2-oxoethyl]-N-(4-fluorophenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[2-(benzylamino)-1-(furan-2-yl)-2-oxoethyl]-N-(4-fluorophenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 3221752 |
| Molecular Formula | C22H17FN4O3S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-[2-(benzylamino)-1-(furan-2-yl)-2-oxoethyl]-N-(4-fluorophenyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C(c1ccco1)N(C(=O)c1csnn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O3S/c23-16-8-10-17(11-9-16)27(22(29)18-14-31-26-25-18)20(19-7-4-12-30-19)21(28)24-13-15-5-2-1-3-6-15/h1-12,14,20H,13H2,(H,24,28) |
| InChIKey | QNQAZNFLFDTBTB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |