C25H22N4O2S — CID 1452073
N-[(1S)-2-(benzylamino)-2-oxo-1-phenylethyl]-N-(4-methylphenyl)thiadiazole-4-carboxamide (PubChem CID 1452073) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[(1S)-2-(benzylamino)-2-oxo-1-phenylethyl]-N-(4-methylphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-[(1S)-2-(benzylamino)-2-oxo-1-phenylethyl]-N-(4-methylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1452073 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[(1S)-2-(benzylamino)-2-oxo-1-phenylethyl]-N-(4-methylphenyl)thiadiazole-4-carboxamide |
| SMILES | Cc1ccc(N(C(=O)c2csnn2)[C@H](C(=O)NCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4O2S/c1-18-12-14-21(15-13-18)29(25(31)22-17-32-28-27-22)23(20-10-6-3-7-11-20)24(30)26-16-19-8-4-2-5-9-19/h2-15,17,23H,16H2,1H3,(H,26,30)/t23-/m0/s1 |
| InChIKey | JRQWFWQRFPOLPL-QHCPKHFHSA-N |
| XLogP | 4.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |