C27H32N2O3 — CID 3219563
N-cyclohexyl-1-(4-ethylphenyl)-2-[2-(2-methoxyphenyl)ethenyl]-4-oxoazetidine-2-carboxamide (PubChem CID 3219563) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is N-cyclohexyl-1-(4-ethylphenyl)-2-[2-(2-methoxyphenyl)ethenyl]-4-oxoazetidine-2-carboxamide.
| Compound Name | N-cyclohexyl-1-(4-ethylphenyl)-2-[2-(2-methoxyphenyl)ethenyl]-4-oxoazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3219563 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-cyclohexyl-1-(4-ethylphenyl)-2-[2-(2-methoxyphenyl)ethenyl]-4-oxoazetidine-2-carboxamide |
| SMILES | CCc1ccc(N2C(=O)CC2(C=Cc2ccccc2OC)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-3-20-13-15-23(16-14-20)29-25(30)19-27(29,26(31)28-22-10-5-4-6-11-22)18-17-21-9-7-8-12-24(21)32-2/h7-9,12-18,22H,3-6,10-11,19H2,1-2H3,(H,28,31) |
| InChIKey | LHSKLRBUDSBRML-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |