C21H30N2O3 — CID 3220971
N-[1-[2-(3-methoxyphenyl)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide (PubChem CID 3220971) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[1-[2-(3-methoxyphenyl)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-(3-methoxyphenyl)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3220971 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[1-[2-(3-methoxyphenyl)-2-oxoethyl]piperidin-4-yl]cyclohexanecarboxamide |
| SMILES | COc1cccc(C(=O)CN2CCC(NC(=O)C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C21H30N2O3/c1-26-19-9-5-8-17(14-19)20(24)15-23-12-10-18(11-13-23)22-21(25)16-6-3-2-4-7-16/h5,8-9,14,16,18H,2-4,6-7,10-13,15H2,1H3,(H,22,25) |
| InChIKey | ZVFXFVPNIRGXQN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |