C25H37N3O3 — CID 42693267
N-cyclohexyl-1-[1-(3-methoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 42693267) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-cyclohexyl-1-[1-(3-methoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-cyclohexyl-1-[1-(3-methoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42693267 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | N-cyclohexyl-1-[1-(3-methoxybenzoyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCC(N3CCC(C(=O)NC4CCCCC4)CC3)CC2)c1 |
| InChI | InChI=1S/C25H37N3O3/c1-31-23-9-5-6-20(18-23)25(30)28-16-12-22(13-17-28)27-14-10-19(11-15-27)24(29)26-21-7-3-2-4-8-21/h5-6,9,18-19,21-22H,2-4,7-8,10-17H2,1H3,(H,26,29) |
| InChIKey | HKGIPQAIYZUHTN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |