C15H29N3O3 — CID 3221021
N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]piperidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 3221021) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]piperidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]piperidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3221021 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]piperidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | COCCNC(=O)CN1CCC(NC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29N3O3/c1-15(2,3)14(20)17-12-5-8-18(9-6-12)11-13(19)16-7-10-21-4/h12H,5-11H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | YADKIFRRZUAAQU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|