C17H23N3O3 — CID 3221049
ethyl 4-(8-azabicyclo[3.2.1]octan-3-ylcarbamoylamino)benzoate (PubChem CID 3221049) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 4-(8-azabicyclo[3.2.1]octan-3-ylcarbamoylamino)benzoate.
| Compound Name | ethyl 4-(8-azabicyclo[3.2.1]octan-3-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 3221049 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethyl 4-(8-azabicyclo[3.2.1]octan-3-ylcarbamoylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)NC2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-2-23-16(21)11-3-5-12(6-4-11)19-17(22)20-15-9-13-7-8-14(10-15)18-13/h3-6,13-15,18H,2,7-10H2,1H3,(H2,19,20,22) |
| InChIKey | IQZRJPNCVYHDEE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |