C20H25N3O4 — CID 3222705
N-(furan-2-ylmethyl)-1-[(3-methoxyphenyl)carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 3222705) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[(3-methoxyphenyl)carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[(3-methoxyphenyl)carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3222705 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[(3-methoxyphenyl)carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | COc1cccc(NC(=O)NC2(C(=O)NCc3ccco3)CCCCC2)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-26-16-8-5-7-15(13-16)22-19(25)23-20(10-3-2-4-11-20)18(24)21-14-17-9-6-12-27-17/h5-9,12-13H,2-4,10-11,14H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | YILUOFMSPWHVGJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |