About benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate
benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 3222942) has the molecular formula C27H26N2O6
and a molecular weight of 474.51 g/mol. Its IUPAC name is benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| PubChem CID | 3222942 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | COc1cccc(NC(=O)c2ccc3c(c2)N(CC(=O)OCc2ccccc2)C(=O)C(C)(C)O3)c1 |
| InChI | InChI=1S/C27H26N2O6/c1-27(2)26(32)29(16-24(30)34-17-18-8-5-4-6-9-18)22-14-19(12-13-23(22)35-27)25(31)28-20-10-7-11-21(15-20)33-3/h4-15H,16-17H2,1-3H3,(H,28,31) |
| InChIKey | ZTFWCNAVUSHUPB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The IUPAC name of benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (CID 3222942) is benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
What is the SMILES notation for benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The canonical SMILES for benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate is COc1cccc(NC(=O)c2ccc3c(c2)N(CC(=O)OCc2ccccc2)C(=O)C(C)(C)O3)c1.
What is the InChIKey of benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The InChIKey is ZTFWCNAVUSHUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O6/c1-27(2)26(32)29(16-24(30)34-17-18-8-5-4-6-9-18)22-14-19(12-13-23(22)35-27)25(31)28-20-10-7-11-21(15-20)33-3/h4-15H,16-17H2,1-3H3,(H,28,31).
What are the key properties of benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate has a molecular weight of 474.51 g/mol, XLogP of 4.19, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[6-[(3-methoxyphenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate is sourced from PubChem (CID 3222942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).